ChemNet > CAS > 637-39-8 Triethanolamine hydrochloride
637-39-8 Triethanolamine hydrochloride
Nazwa produktu: |
Triethanolamine hydrochloride |
Angielska nazwa |
Triethanolamine hydrochloride; 2,2,2-Nitrilotriethanol hydrochloride~Tris(2-hydroxyethyl)amine hydrochloride; triethanolamine hcl; tris(2-hydroxyethyl)ammonium chloride; 2,2',2''-nitrilotriethanol hydrochloride (1:1) |
MF |
C6H16ClNO3 |
Masie cząsteczkowej |
185.6491 |
InChI |
InChI=1/C6H15NO3.ClH/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;1H |
Nr CAS |
637-39-8 |
EINECS |
211-284-2 |
Struktury molekularnej |
|
Temperatura topnienia |
177-179℃ |
Temperatura wrzenia |
335.4°C at 760 mmHg |
Temperatura zapłonu |
185°C |
Ciśnienie pary |
8.38E-06mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|