ChemNet > CAS > 637-90-1 1,2-Epoxy-5-cyclooctene
637-90-1 1,2-Epoxy-5-cyclooctene
| Nazwa produktu: |
1,2-Epoxy-5-cyclooctene |
| Angielska nazwa |
1,2-Epoxy-5-cyclooctene; 9-oxabicyclo(6.1.0)non-4-ene; 9-Oxabicyclo[6.1.0]non-4-ene; (4Z)-9-oxabicyclo[6.1.0]non-4-ene; (1S,4Z,8S)-9-oxabicyclo[6.1.0]non-4-ene |
| MF |
C8H12O |
| Masie cząsteczkowej |
124.1803 |
| InChI |
InChI=1/C8H12O/c1-2-4-6-8-7(9-8)5-3-1/h1-2,7-8H,3-6H2/b2-1-/t7-,8-/m0/s1 |
| Nr CAS |
637-90-1 |
| EINECS |
211-308-1 |
| Struktury molekularnej |
|
| Gęstość |
0.993g/cm3 |
| Temperatura wrzenia |
178.1°C at 760 mmHg |
| Współczynnik załamania |
1.49 |
| Temperatura zapłonu |
54.3°C |
| Ciśnienie pary |
1.36mmHg at 25°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
