ChemNet > CAS > 64218-50-4 2-chloro-1-(4,5-dichloro-2-tienylo)etan-1-on
64218-50-4 2-chloro-1-(4,5-dichloro-2-tienylo)etan-1-on
| Nazwa produktu: |
2-chloro-1-(4,5-dichloro-2-tienylo)etan-1-on |
| Synonimy |
2-chloro-1-(4,5-dichlorotiofen-2-ylo)etanon |
| Angielska nazwa |
2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one;2-chloro-1-(4,5-dichlorothiophen-2-yl)ethanone |
| MF |
C6H3Cl3OS |
| Masie cząsteczkowej |
229.5114 |
| InChI |
InChI=1/C6H3Cl3OS/c7-2-4(10)5-1-3(8)6(9)11-5/h1H,2H2 |
| Nr CAS |
64218-50-4 |
| Struktury molekularnej |
|
| Gęstość |
1.574g/cm3 |
| Temperatura topnienia |
56℃ |
| Temperatura wrzenia |
355.8°C at 760 mmHg |
| Współczynnik załamania |
1.591 |
| Temperatura zapłonu |
169°C |
| Ciśnienie pary |
3.05E-05mmHg at 25°C |
| Symbole zagrożenia |
 C:Corrosive;
|
| Kody ryzyka |
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
