ChemNet > CAS > 643-28-7 2-Isopropylaniline
643-28-7 2-Isopropylaniline
| Nazwa produktu: |
2-Isopropylaniline |
| Angielska nazwa |
2-Isopropylaniline; 2-Aminocumene; 2-(1-methylethyl)-benzenamine; 2-(propan-2-yl)aniline |
| MF |
C9H13N |
| Masie cząsteczkowej |
135.2062 |
| InChI |
InChI=1/C9H13N/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,10H2,1-2H3 |
| Nr CAS |
643-28-7 |
| EINECS |
211-397-7 |
| Struktury molekularnej |
|
| Gęstość |
0.953g/cm3 |
| Temperatura wrzenia |
225.6°C at 760 mmHg |
| Współczynnik załamania |
1.542 |
| Temperatura zapłonu |
95.6°C |
| Ciśnienie pary |
0.0858mmHg at 25°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
