6483-50-7 1,4-Diethylpiperazine
Nazwa produktu: |
1,4-Diethylpiperazine |
Angielska nazwa |
1,4-Diethylpiperazine;Piperazine, 1,4-diethyl-; 1,4-diethylpiperazinediium |
MF |
C8H20N2 |
Masie cząsteczkowej |
144.2567 |
InChI |
InChI=1/C8H18N2/c1-3-9-5-7-10(4-2)8-6-9/h3-8H2,1-2H3/p+2 |
Nr CAS |
6483-50-7 |
EINECS |
229-341-5 |
Struktury molekularnej |
|
Temperatura wrzenia |
185°C at 760 mmHg |
Temperatura zapłonu |
58.1°C |
Ciśnienie pary |
0.714mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|