ChemNet > CAS > 6575-13-9 2,6-Dimethylbenzonitrile
6575-13-9 2,6-Dimethylbenzonitrile
Nazwa produktu: |
2,6-Dimethylbenzonitrile |
Angielska nazwa |
2,6-Dimethylbenzonitrile; 2,6-Dimethylbenzoniitrile |
MF |
C9H9N |
Masie cząsteczkowej |
131.1745 |
InChI |
InChI=1/C9H9N/c1-7-4-3-5-8(2)9(7)6-10/h3-5H,1-2H3 |
Nr CAS |
6575-13-9 |
EINECS |
229-503-5 |
Struktury molekularnej |
|
Gęstość |
0.99g/cm3 |
Temperatura topnienia |
87-89℃ |
Temperatura wrzenia |
228.7°C at 760 mmHg |
Współczynnik załamania |
1.525 |
Temperatura zapłonu |
91.9°C |
Ciśnienie pary |
0.0725mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|