ChemNet > CAS > 6635-41-2 2-Nitrobenzaldoxime
6635-41-2 2-Nitrobenzaldoxime
| Nazwa produktu: |
2-Nitrobenzaldoxime |
| Angielska nazwa |
2-Nitrobenzaldoxime; 2-Nitrobenzaldoxime, (2-Nitrobenzaldehyde oxime); 2-Nitrobenzaldehyde oxime; N-hydroxy-1-(2-nitrophenyl)methanimine |
| MF |
C7H6N2O3 |
| Masie cząsteczkowej |
166.1341 |
| InChI |
InChI=1/C7H6N2O3/c10-8-5-6-3-1-2-4-7(6)9(11)12/h1-5,10H/b8-5- |
| Nr CAS |
6635-41-2 |
| EINECS |
229-634-8 |
| Struktury molekularnej |
|
| Gęstość |
1.33g/cm3 |
| Temperatura topnienia |
98-100℃ |
| Temperatura wrzenia |
305.2°C at 760 mmHg |
| Współczynnik załamania |
1.589 |
| Temperatura zapłonu |
138.4°C |
| Ciśnienie pary |
0.000366mmHg at 25°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
