ChemNet > CAS > 66399-30-2 (S)-1-(4-Fluorophenyl)ethylamine
66399-30-2 (S)-1-(4-Fluorophenyl)ethylamine
Nazwa produktu: |
(S)-1-(4-Fluorophenyl)ethylamine |
Angielska nazwa |
(S)-1-(4-Fluorophenyl)ethylamine; (S)-(-)-1-(4-Fluorophenyl)ethylamine; (S)-4-Fluoro-alpha-methylbenzylamine; 1-bromo-2,3,4-trichloro-1,1,2-trifluorobutane; (1S)-1-(4-fluorophenyl)ethanamine |
MF |
C8H10FN |
Masie cząsteczkowej |
139.1701 |
InChI |
InChI=1/C8H10FN/c1-6(10)7-2-4-8(9)5-3-7/h2-6H,10H2,1H3/t6-/m0/s1 |
Nr CAS |
66399-30-2 |
Struktury molekularnej |
|
Gęstość |
1.063g/cm3 |
Temperatura wrzenia |
185.4°C at 760 mmHg |
Współczynnik załamania |
1.512 |
Temperatura zapłonu |
74°C |
Ciśnienie pary |
0.698mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|