ChemNet > CAS > 6705-03-9 2-Amino-5-methoxybenzoic acid
6705-03-9 2-Amino-5-methoxybenzoic acid
Nazwa produktu: |
2-Amino-5-methoxybenzoic acid |
Angielska nazwa |
2-Amino-5-methoxybenzoic acid; 5-Methoxyanthranilic acid; 2-Amino-5-methoxy-benzoic acid |
MF |
C8H8N2O |
Masie cząsteczkowej |
148.1619 |
InChI |
InChI=1/C8H8N2O/c1-11-7-2-3-8(10)6(4-7)5-9/h2-4H,10H2,1H3 |
Nr CAS |
6705-03-9 |
Struktury molekularnej |
|
Gęstość |
1.17g/cm3 |
Temperatura topnienia |
148-152℃ |
Temperatura wrzenia |
302.2°C at 760 mmHg |
Współczynnik załamania |
1.569 |
Temperatura zapłonu |
136.6°C |
Ciśnienie pary |
0.00101mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R22:;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|