6833-15-4 4-chlorobenzanilid
Nazwa produktu: |
4-chlorobenzanilid |
Synonimy |
4-chloro-N-fenylobenzamid |
Angielska nazwa |
4-chlorobenzanilide; 4-chloro-N-phenylbenzamide |
MF |
C13H10ClNO |
Masie cząsteczkowej |
231.6776 |
InChI |
InChI=1/C13H10ClNO/c14-11-8-6-10(7-9-11)13(16)15-12-4-2-1-3-5-12/h1-9H,(H,15,16) |
Nr CAS |
6833-15-4 |
Struktury molekularnej |
|
Gęstość |
1.285g/cm3 |
Temperatura topnienia |
199-201℃ |
Temperatura wrzenia |
288.6°C at 760 mmHg |
Współczynnik załamania |
1.649 |
Temperatura zapłonu |
128.3°C |
Ciśnienie pary |
0.00232mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|