ChemNet > CAS > 69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
| Nazwa produktu: |
methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate |
| Angielska nazwa |
methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate; Methyl 2,5-dimethylpyrrole-3-carboxylate |
| MF |
C8H11NO2 |
| Masie cząsteczkowej |
153.1784 |
| InChI |
InChI=1/C8H11NO2/c1-5-4-7(6(2)9-5)8(10)11-3/h4,9H,1-3H3 |
| Nr CAS |
69687-80-5 |
| Struktury molekularnej |
|
| Gęstość |
1.108g/cm3 |
| Temperatura topnienia |
115℃ |
| Temperatura wrzenia |
294.3°C at 760 mmHg |
| Współczynnik załamania |
1.521 |
| Temperatura zapłonu |
131.8°C |
| Ciśnienie pary |
0.00163mmHg at 25°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
