ChemNet > CAS > 700-35-6 2-chloro-4-fluoroacetophenone
700-35-6 2-chloro-4-fluoroacetophenone
Nazwa produktu: |
2-chloro-4-fluoroacetophenone |
Angielska nazwa |
2-chloro-4-fluoroacetophenone; 2'-chloro-4'-fluoroacetophenone; 1-(2-chloro-4-fluoro-phenyl)ethanone |
MF |
C8H6ClFO |
Masie cząsteczkowej |
172.584 |
InChI |
InChI=1/C8H6ClFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
Nr CAS |
700-35-6 |
Struktury molekularnej |
|
Gęstość |
1.259g/cm3 |
Temperatura wrzenia |
203.4°C at 760 mmHg |
Współczynnik załamania |
1.512 |
Temperatura zapłonu |
76.814°C |
Ciśnienie pary |
0.278mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|