ChemNet > CAS > 7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
Nazwa produktu: |
1,3-dichloro-2-methyl-5-nitrobenzene |
Angielska nazwa |
1,3-dichloro-2-methyl-5-nitrobenzene; 2,6-Dichloro-4-nitrotoluene |
MF |
C7H5Cl2NO2 |
Masie cząsteczkowej |
206.0261 |
InChI |
InChI=1/C7H5Cl2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
Nr CAS |
7149-69-1 |
Struktury molekularnej |
|
Gęstość |
1.456g/cm3 |
Temperatura topnienia |
62℃ |
Temperatura wrzenia |
279.6°C at 760 mmHg |
Współczynnik załamania |
1.585 |
Temperatura zapłonu |
122.9°C |
Ciśnienie pary |
0.00674mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|