733-07-3 dimesitylmethane
Nazwa produktu: |
dimesitylmethane |
Angielska nazwa |
dimesitylmethane; Bis(2,4,6-trimethylphenyl)methane~2,2-Methylenedimesitylene; 1,1-Methylenebis-(2,4,6-trimethylbenzene); 1,1'-methanediylbis(2,4,6-trimethylbenzene) |
MF |
C19H24 |
Masie cząsteczkowej |
252.3939 |
InChI |
InChI=1/C19H24/c1-12-7-14(3)18(15(4)8-12)11-19-16(5)9-13(2)10-17(19)6/h7-10H,11H2,1-6H3 |
Nr CAS |
733-07-3 |
EINECS |
211-991-6 |
Struktury molekularnej |
|
Gęstość |
0.947g/cm3 |
Temperatura topnienia |
132-135℃ |
Temperatura wrzenia |
370.7°C at 760 mmHg |
Współczynnik załamania |
1.547 |
Temperatura zapłonu |
192.8°C |
Ciśnienie pary |
2.31E-05mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|