ChemNet > CAS > 7459-46-3 Triethyl 1,1,2-ethanetricarboxylate
7459-46-3 Triethyl 1,1,2-ethanetricarboxylate
Nazwa produktu: |
Triethyl 1,1,2-ethanetricarboxylate |
Angielska nazwa |
Triethyl 1,1,2-ethanetricarboxylate; 1,1,2-Ethanetricarboxylic acid triethyl ester; Triethyl ethane-1,1,2-tricarboxylate; 1,1,2-Ethanetricarboxylic acid, 1,1,2-triethyl ester;
|
MF |
C11H18O6 |
Masie cząsteczkowej |
246.257 |
InChI |
InChI=1/C11H18O6/c1-4-15-9(12)7-8(10(13)16-5-2)11(14)17-6-3/h8H,4-7H2,1-3H3 |
Nr CAS |
7459-46-3 |
EINECS |
231-235-9 |
Struktury molekularnej |
|
Gęstość |
1.114g/cm3 |
Temperatura wrzenia |
300.7°C at 760 mmHg |
Współczynnik załamania |
1.44 |
Temperatura zapłonu |
127.4°C |
Ciśnienie pary |
0.0011mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|