75-27-4 Bromodichloromethane
Nazwa produktu: |
Bromodichloromethane |
Angielska nazwa |
Bromodichloromethane; FC-20B1 |
MF |
CHBrCl2 |
Masie cząsteczkowej |
163.8286 |
InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
Nr CAS |
75-27-4 |
EINECS |
200-856-7 |
Struktury molekularnej |
|
Gęstość |
2.013g/cm3 |
Temperatura topnienia |
-55℃ |
Temperatura wrzenia |
89.7°C at 760 mmHg |
Współczynnik załamania |
1.503 |
Temperatura zapłonu |
1.3°C |
Ciśnienie pary |
65.3mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|