ChemNet > CAS > 75705-21-4 4-Aminomethylphenylboronic acid hydrochloride
75705-21-4 4-Aminomethylphenylboronic acid hydrochloride
Nazwa produktu: |
4-Aminomethylphenylboronic acid hydrochloride |
Angielska nazwa |
4-Aminomethylphenylboronic acid hydrochloride; [4-(aminomethyl)phenyl]boronic acid |
MF |
C7H10BNO2 |
Masie cząsteczkowej |
150.9708 |
InChI |
InChI=1/C7H10BNO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,10-11H,5,9H2 |
Nr CAS |
75705-21-4 |
Struktury molekularnej |
|
Gęstość |
1.18g/cm3 |
Temperatura wrzenia |
337.7°C at 760 mmHg |
Współczynnik załamania |
1.567 |
Temperatura zapłonu |
158.1°C |
Ciśnienie pary |
4.02E-05mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|