ChemNet > CAS > 7697-29-2 4-Chloro-3-methylbenzoic acid
7697-29-2 4-Chloro-3-methylbenzoic acid
Nazwa produktu: |
4-Chloro-3-methylbenzoic acid |
Angielska nazwa |
4-Chloro-3-methylbenzoic acid; 3-Methyl -4-Chlorobenzoic acid; 3-methyl-4-chlorobenzoic acid; 4-CHLORO-M-TOLUIC ACID; 4-Chloro-3-toluic acid; 4-Chloro-3-Methyl |
MF |
C8H7ClO2 |
Masie cząsteczkowej |
170.593 |
InChI |
InChI=1/C8H7ClO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11) |
Nr CAS |
7697-29-2 |
Struktury molekularnej |
|
Gęstość |
1.31g/cm3 |
Temperatura wrzenia |
299°C at 760 mmHg |
Współczynnik załamania |
1.573 |
Temperatura zapłonu |
134.6°C |
Ciśnienie pary |
0.000548mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|