ChemNet > CAS > 76989-89-4 Cyanourea, sodium salt
76989-89-4 Cyanourea, sodium salt
| Nazwa produktu: |
Cyanourea, sodium salt |
| Angielska nazwa |
Cyanourea, sodium salt; Cyanourea sodium salt; Cyanoisourea sodium salt; 1-cyanourea; sodium N'-cyanoimidocarbamate |
| MF |
C2H2N3NaO |
| Masie cząsteczkowej |
107.0465 |
| InChI |
InChI=1/C2H3N3O.Na/c3-1-5-2(4)6;/h(H3,4,5,6);/q;+1/p-1 |
| Nr CAS |
76989-89-4 |
| EINECS |
278-584-3 |
| Struktury molekularnej |
|
| Temperatura topnienia |
300℃ |
| Temperatura wrzenia |
263.3°C at 760 mmHg |
| Temperatura zapłonu |
113.1°C |
| Ciśnienie pary |
0.00146mmHg at 25°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|
