ChemNet > CAS > 771-97-1 2,3-Diaminonaphthalene
771-97-1 2,3-Diaminonaphthalene
| Nazwa produktu: |
2,3-Diaminonaphthalene |
| Angielska nazwa |
2,3-Diaminonaphthalene; 2,3-Naphthalenediamine; naphthalene-2,3-diamine |
| MF |
C10H10N2 |
| Masie cząsteczkowej |
158.1998 |
| InChI |
InChI=1/C10H10N2/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6H,11-12H2 |
| Nr CAS |
771-97-1 |
| EINECS |
212-241-0 |
| Struktury molekularnej |
|
| Gęstość |
1.234g/cm3 |
| Temperatura topnienia |
193-199℃ |
| Temperatura wrzenia |
370.6°C at 760 mmHg |
| Współczynnik załamania |
1.757 |
| Temperatura zapłonu |
212.3°C |
| Ciśnienie pary |
1.1E-05mmHg at 25°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
