ChemNet > CAS > 78583-81-0 3-(4-chlorophenyl)-1H-pyrazol-5-amine
78583-81-0 3-(4-chlorophenyl)-1H-pyrazol-5-amine
| Nazwa produktu: |
3-(4-chlorophenyl)-1H-pyrazol-5-amine |
| Angielska nazwa |
3-(4-chlorophenyl)-1H-pyrazol-5-amine; 5-(4-chlorophenyl)-1H-pyrazol-3-amine |
| MF |
C9H8ClN3 |
| Masie cząsteczkowej |
193.6329 |
| InChI |
InChI=1/C9H8ClN3/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,(H3,11,12,13) |
| Nr CAS |
78583-81-0 |
| Struktury molekularnej |
|
| Gęstość |
1.378g/cm3 |
| Temperatura topnienia |
172℃ |
| Temperatura wrzenia |
463.8°C at 760 mmHg |
| Współczynnik załamania |
1.67 |
| Temperatura zapłonu |
234.3°C |
| Ciśnienie pary |
8.78E-09mmHg at 25°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
