ChemNet > CAS > 78686-87-0 chlorek 2,5-dichloropirydyno-3-karbonylu
78686-87-0 chlorek 2,5-dichloropirydyno-3-karbonylu
| Nazwa produktu: |
chlorek 2,5-dichloropirydyno-3-karbonylu |
| Angielska nazwa |
2,5-dichloropyridine-3-carbonyl chloride; |
| MF |
C6H2Cl3NO |
| Masie cząsteczkowej |
210.4452 |
| InChI |
InChI=1/C6H2Cl3NO/c7-3-1-4(6(9)11)5(8)10-2-3/h1-2H |
| Nr CAS |
78686-87-0 |
| Struktury molekularnej |
|
| Gęstość |
1.582g/cm3 |
| Temperatura wrzenia |
269°C at 760 mmHg |
| Współczynnik załamania |
1.582 |
| Temperatura zapłonu |
116.5°C |
| Ciśnienie pary |
0.00745mmHg at 25°C |
| Symbole zagrożenia |
 C:Corrosive;
|
| Kody ryzyka |
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
