ChemNet > CAS > 79636-94-5 5-Bromo-2-ethoxybenzaldehyde
79636-94-5 5-Bromo-2-ethoxybenzaldehyde
| Nazwa produktu: |
5-Bromo-2-ethoxybenzaldehyde |
| Angielska nazwa |
5-Bromo-2-ethoxybenzaldehyde; |
| MF |
C9H9BrO2 |
| Masie cząsteczkowej |
229.0706 |
| InChI |
InChI=1/C9H9BrO2/c1-2-12-9-4-3-8(10)5-7(9)6-11/h3-6H,2H2,1H3 |
| Nr CAS |
79636-94-5 |
| Struktury molekularnej |
|
| Gęstość |
1.451g/cm3 |
| Temperatura topnienia |
68℃ |
| Temperatura wrzenia |
302.7°C at 760 mmHg |
| Współczynnik załamania |
1.573 |
| Temperatura zapłonu |
136.9°C |
| Ciśnienie pary |
0.000974mmHg at 25°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
