ChemNet > CAS > 80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
| Nazwa produktu: |
4-Methyl-3-nitrobenzeneboronic acid |
| Angielska nazwa |
4-Methyl-3-nitrobenzeneboronic acid; 4-Methyl-3-nitrophenylboronic acid; 3-Nitro-p-tolylboronic acid; (4-methyl-3-nitrophenyl)boronic acid; 4-methyl-3-nitrophenylboronic acid; 3-Nitropheny-4-methylphenylboronic acid |
| MF |
C7H8BNO4 |
| Masie cząsteczkowej |
180.9537 |
| InChI |
InChI=1/C7H8BNO4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4,10-11H,1H3 |
| Nr CAS |
80500-27-2 |
| Struktury molekularnej |
|
| Gęstość |
1.33g/cm3 |
| Temperatura topnienia |
265-270 °C(lit.) |
| Temperatura wrzenia |
356.7°C at 760 mmHg |
| Współczynnik załamania |
1.563 |
| Temperatura zapłonu |
169.5°C |
| Ciśnienie pary |
1.05E-05mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
