ChemNet > CAS > 80866-75-7 3-Methyl-4-nitrobenzyl alcohol
80866-75-7 3-Methyl-4-nitrobenzyl alcohol
Nazwa produktu: |
3-Methyl-4-nitrobenzyl alcohol |
Angielska nazwa |
3-Methyl-4-nitrobenzyl alcohol; (3-methyl-4-nitrophenyl)methanol |
MF |
C8H9NO3 |
Masie cząsteczkowej |
167.162 |
InChI |
InChI=1/C8H9NO3/c1-6-4-7(5-10)2-3-8(6)9(11)12/h2-4,10H,5H2,1H3 |
Nr CAS |
80866-75-7 |
EINECS |
279-578-3 |
Struktury molekularnej |
|
Gęstość |
1.272g/cm3 |
Temperatura topnienia |
56-60℃ |
Temperatura wrzenia |
322.6°C at 760 mmHg |
Współczynnik załamania |
1.585 |
Temperatura zapłonu |
145.2°C |
Ciśnienie pary |
0.000114mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|