ChemNet > CAS > 81067-38-1 1-Bromo-2,3,5-trichlorobenzene
81067-38-1 1-Bromo-2,3,5-trichlorobenzene
| Nazwa produktu: |
1-Bromo-2,3,5-trichlorobenzene |
| Angielska nazwa |
1-Bromo-2,3,5-trichlorobenzene; 2,3,5-Trichlorobromobenzene |
| MF |
C6H2BrCl3 |
| Masie cząsteczkowej |
260.3431 |
| InChI |
InChI=1/C6H2BrCl3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
| Nr CAS |
81067-38-1 |
| Struktury molekularnej |
|
| Gęstość |
1.84g/cm3 |
| Temperatura topnienia |
58-61℃ |
| Temperatura wrzenia |
270.8°C at 760 mmHg |
| Współczynnik załamania |
1.603 |
| Temperatura zapłonu |
129.3°C |
| Ciśnienie pary |
0.0111mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
