827-15-6 iodopentafluorobenzene
Nazwa produktu: |
iodopentafluorobenzene |
Angielska nazwa |
iodopentafluorobenzene; Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene; 1-Iodo-2,3,4,5,6-Pentafluorobenzene |
MF |
C6F5I |
Masie cząsteczkowej |
293.9607 |
InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
Nr CAS |
827-15-6 |
EINECS |
212-565-2 |
Struktury molekularnej |
|
Gęstość |
2.217g/cm3 |
Temperatura wrzenia |
166.7°C at 760 mmHg |
Współczynnik załamania |
1.502 |
Temperatura zapłonu |
61.3°C |
Ciśnienie pary |
2.33mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|