ChemNet > CAS > 840-65-3 dimethyl naphthalene-2,6-dicarboxylate
840-65-3 dimethyl naphthalene-2,6-dicarboxylate
Nazwa produktu: |
dimethyl naphthalene-2,6-dicarboxylate |
Angielska nazwa |
dimethyl naphthalene-2,6-dicarboxylate; Naphthalene-2,6-dicarboxylic acid dimethyl ester; Dimethyl-2,6-naphthalene dicaboxylate; 2,6-DMN; Dimethyl 2,6-Naphthalenedicarboxylate |
MF |
C14H12O4 |
Masie cząsteczkowej |
244.2427 |
InChI |
InChI=1/C14H12O4/c1-17-13(15)11-5-3-10-8-12(14(16)18-2)6-4-9(10)7-11/h3-8H,1-2H3 |
Nr CAS |
840-65-3 |
EINECS |
212-661-4 |
Struktury molekularnej |
|
Gęstość |
1.225g/cm3 |
Temperatura topnienia |
187-190℃ |
Temperatura wrzenia |
375.3°C at 760 mmHg |
Współczynnik załamania |
1.594 |
Temperatura zapłonu |
189.2°C |
Ciśnienie pary |
7.88E-06mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|