ChemNet > CAS > 84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
| Nazwa produktu: |
4-Dimethylamino-2-methoxybenzaldehyde |
| Angielska nazwa |
4-Dimethylamino-2-methoxybenzaldehyde; |
| MF |
C10H13NO2 |
| Masie cząsteczkowej |
179.2157 |
| InChI |
InChI=1/C10H13NO2/c1-11(2)9-5-4-8(7-12)10(6-9)13-3/h4-7H,1-3H3 |
| Nr CAS |
84562-48-1 |
| Struktury molekularnej |
|
| Gęstość |
1.098g/cm3 |
| Temperatura topnienia |
59-60℃ |
| Temperatura wrzenia |
305.9°C at 760 mmHg |
| Współczynnik załamania |
1.576 |
| Temperatura zapłonu |
138.8°C |
| Ciśnienie pary |
0.000796mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
