86-26-0 2-Methoxybiphenyl
Nazwa produktu: |
2-Methoxybiphenyl |
Angielska nazwa |
2-Methoxybiphenyl; 2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
MF |
C13H12O |
Masie cząsteczkowej |
184.2338 |
InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
Nr CAS |
86-26-0 |
EINECS |
201-659-9 |
Struktury molekularnej |
|
Gęstość |
1.03g/cm3 |
Temperatura topnienia |
30-33℃ |
Temperatura wrzenia |
274°C at 760 mmHg |
Współczynnik załamania |
1.556 |
Temperatura zapłonu |
101.3°C |
Ciśnienie pary |
0.00928mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R33:Danger of cummulative effects.;
|
Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|