ChemNet > CAS > 86010-32-4 5-nitro-1-benzothiophene-2-carbonyl chloride
86010-32-4 5-nitro-1-benzothiophene-2-carbonyl chloride
Nazwa produktu: |
5-nitro-1-benzothiophene-2-carbonyl chloride |
Angielska nazwa |
5-nitro-1-benzothiophene-2-carbonyl chloride; |
MF |
C9H4ClNO3S |
Masie cząsteczkowej |
241.651 |
InChI |
InChI=1/C9H4ClNO3S/c10-9(12)8-4-5-3-6(11(13)14)1-2-7(5)15-8/h1-4H |
Nr CAS |
86010-32-4 |
Struktury molekularnej |
|
Gęstość |
1.597g/cm3 |
Temperatura topnienia |
158℃ |
Temperatura wrzenia |
401.7°C at 760 mmHg |
Współczynnik załamania |
1.712 |
Temperatura zapłonu |
196.7°C |
Ciśnienie pary |
1.16E-06mmHg at 25°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|