ChemNet > CAS > 871-78-3 N,N'-Diacetylethylenediamine
871-78-3 N,N'-Diacetylethylenediamine
| Nazwa produktu: |
N,N'-Diacetylethylenediamine |
| Angielska nazwa |
N,N'-Diacetylethylenediamine; N,N-Diacetylethylenediamine; N,N'-ethane-1,2-diyldiacetamide |
| MF |
C6H12N2O2 |
| Masie cząsteczkowej |
144.1717 |
| InChI |
InChI=1/C6H12N2O2/c1-5(9)7-3-4-8-6(2)10/h3-4H2,1-2H3,(H,7,9)(H,8,10) |
| Nr CAS |
871-78-3 |
| EINECS |
212-811-9 |
| Struktury molekularnej |
|
| Gęstość |
1.033g/cm3 |
| Temperatura wrzenia |
438.7°C at 760 mmHg |
| Współczynnik załamania |
1.444 |
| Temperatura zapłonu |
214.8°C |
| Ciśnienie pary |
6.74E-08mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
