ChemNet > CAS > 89581-82-8 2-Acetyl-3-chlorothiophene
89581-82-8 2-Acetyl-3-chlorothiophene
| Nazwa produktu: |
2-Acetyl-3-chlorothiophene |
| Angielska nazwa |
2-Acetyl-3-chlorothiophene;1-(3-chlorothiophen-2-yl)ethanone |
| MF |
C6H5ClOS |
| Masie cząsteczkowej |
160.6213 |
| InChI |
InChI=1/C6H5ClOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
| Nr CAS |
89581-82-8 |
| Struktury molekularnej |
|
| Gęstość |
1.312g/cm3 |
| Temperatura wrzenia |
219.9°C at 760 mmHg |
| Współczynnik załamania |
1.559 |
| Temperatura zapłonu |
86.8°C |
| Ciśnienie pary |
0.116mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
