ChemNet > CAS > 89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
| Nazwa produktu: |
Methyl-2-chloro-6-methylpyrimidine-4-carboxylate |
| Angielska nazwa |
Methyl-2-chloro-6-methylpyrimidine-4-carboxylate; Methyl 2-chloro-6-methylpyrimidine-4-carboxylate |
| MF |
C7H7ClN2O2 |
| Masie cząsteczkowej |
186.5957 |
| InChI |
InChI=1/C7H7ClN2O2/c1-4-3-5(6(11)12-2)10-7(8)9-4/h3H,1-2H3 |
| Nr CAS |
89793-11-3 |
| Struktury molekularnej |
|
| Gęstość |
1.314g/cm3 |
| Temperatura topnienia |
107℃ |
| Temperatura wrzenia |
306.5°C at 760 mmHg |
| Współczynnik załamania |
1.53 |
| Temperatura zapłonu |
139.2°C |
| Ciśnienie pary |
0.000768mmHg at 25°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
