ChemNet > CAS > 90002-36-1 2-Ethylbenzeneboronic acid
90002-36-1 2-Ethylbenzeneboronic acid
Nazwa produktu: |
2-Ethylbenzeneboronic acid |
Angielska nazwa |
2-Ethylbenzeneboronic acid; 2-Ethylphenylboronic acid; RNase A |
MF |
C8H11BO2 |
Masie cząsteczkowej |
149.9827 |
InChI |
InChI=1/C8H11BO2/c1-2-7-5-3-4-6-8(7)9(10)11/h3-6,10-11H,2H2,1H3 |
Nr CAS |
90002-36-1 |
Struktury molekularnej |
|
Gęstość |
1.07g/cm3 |
Temperatura topnienia |
102.5-107.5℃ |
Temperatura wrzenia |
299.1°C at 760 mmHg |
Współczynnik załamania |
1.521 |
Temperatura zapłonu |
134.7°C |
Ciśnienie pary |
0.000544mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|