ChemNet > CAS > 9002-83-9 poly(chlorotrifluoroethylene)
9002-83-9 poly(chlorotrifluoroethylene)
Nazwa produktu: |
poly(chlorotrifluoroethylene) |
Angielska nazwa |
poly(chlorotrifluoroethylene); halocarbon oil 27 insect cell*culture tested; Fluorolube grease; PCTFE; Fluorolube Grease, Gr-362 |
MF |
C2ClF3 |
Masie cząsteczkowej |
116.4693 |
InChI |
InChI=1/C2ClF3/c3-1(4)2(5)6 |
Nr CAS |
9002-83-9 |
Struktury molekularnej |
|
Gęstość |
1.9 |
Temperatura topnienia |
210℃ |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|