ChemNet > CAS > 90259-31-7 2-Bromo-6-methylbenzoic acid
90259-31-7 2-Bromo-6-methylbenzoic acid
Nazwa produktu: |
2-Bromo-6-methylbenzoic acid |
Angielska nazwa |
2-Bromo-6-methylbenzoic acid; 6-Bromo-o-toluic acid |
MF |
C8H7BrO2 |
Masie cząsteczkowej |
215.044 |
InChI |
InChI=1/C8H7BrO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
Nr CAS |
90259-31-7 |
Struktury molekularnej |
|
Gęstość |
1.6g/cm3 |
Temperatura topnienia |
108-112℃ |
Temperatura wrzenia |
307.043°C at 760 mmHg |
Współczynnik załamania |
1.595 |
Temperatura zapłonu |
139.495°C |
Ciśnienie pary |
0mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R22:;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|