ChemNet > CAS > 931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
| Nazwa produktu: |
1,2-Cyclohexanediol, mixture of cis and trans |
| Angielska nazwa |
1,2-Cyclohexanediol, mixture of cis and trans; 1,2-Cyclohexanediol, cis/trans-mix; 1,2-Cyclohexanediol; 1,2-Cyclohexandiol |
| MF |
C6H12O2 |
| Masie cząsteczkowej |
116.16 |
| InChI |
InChI=1/C6H12O2/c7-5-3-1-2-4-6(5)8/h5-8H,1-4H2 |
| Nr CAS |
931-17-9 |
| EINECS |
213-229-8 |
| Struktury molekularnej |
|
| Temperatura topnienia |
73-77℃ |
| Temperatura wrzenia |
118-120℃ (10 mmHg) |
| Rozpuszczalność w wodzie |
soluble |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S23:;
S24/25:;
|
|
