933-75-5 2,3,6-Trichlorophenol

Nazwa produktu:	2,3,6-Trichlorophenol
Angielska nazwa	2,3,6-Trichlorophenol;
MF	C₆H₃Cl₃O
Masie cząsteczkowej	197.4464
InChI	InChI=1/C6H3Cl3O/c7-3-1-2-4(8)6(10)5(3)9/h1-2,10H
Nr CAS	933-75-5
EINECS	213-271-7
Struktury molekularnej
Gęstość	1.596g/cm³
Temperatura topnienia	53-57℃
Temperatura wrzenia	230.6°C at 760 mmHg
Współczynnik załamania	1.608
Temperatura zapłonu	93.3°C
Ciśnienie pary	0.043mmHg at 25°C
Symbole zagrożenia	Xn:Harmful;
Kody ryzyka	R22:Harmful if swallowed.; R36/38:Irritating to eyes and skin.;
Bezpieczeństwo opis	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.;