ChemNet > CAS > 944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
| Nazwa produktu: |
4-amino-2,3,5,6-tetrafluorobenzoic acid |
| Angielska nazwa |
4-amino-2,3,5,6-tetrafluorobenzoic acid; |
| MF |
C7H3F4NO2 |
| Masie cząsteczkowej |
209.0978 |
| InChI |
InChI=1/C7H3F4NO2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H,13,14) |
| Nr CAS |
944-43-4 |
| EINECS |
213-409-6 |
| Struktury molekularnej |
|
| Gęstość |
1.726g/cm3 |
| Temperatura topnienia |
185-187℃ |
| Temperatura wrzenia |
283.6°C at 760 mmHg |
| Współczynnik załamania |
1.529 |
| Temperatura zapłonu |
125.3°C |
| Ciśnienie pary |
0.00148mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
