ChemNet > CAS > 95201-93-7 Methyl 4-bromo-3-hydroxythiophene-2-carboxylate
95201-93-7 Methyl 4-bromo-3-hydroxythiophene-2-carboxylate
| Nazwa produktu: |
Methyl 4-bromo-3-hydroxythiophene-2-carboxylate |
| Angielska nazwa |
Methyl 4-bromo-3-hydroxythiophene-2-carboxylate;4-bromo-2-[hydroxy(methoxy)methylidene]thiophen-3(2H)-one |
| MF |
C6H5BrO3S |
| Masie cząsteczkowej |
237.0711 |
| InChI |
InChI=1/C6H5BrO3S/c1-10-6(9)5-4(8)3(7)2-11-5/h2,8H,1H3 |
| Nr CAS |
95201-93-7 |
| Struktury molekularnej |
|
| Gęstość |
1.804g/cm3 |
| Temperatura topnienia |
79-80℃ |
| Temperatura wrzenia |
247.887°C at 760 mmHg |
| Współczynnik załamania |
1.617 |
| Temperatura zapłonu |
103.718°C |
| Ciśnienie pary |
0.016mmHg at 25°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
