96-04-8 2,3-heptanedione
Nazwa produktu: |
2,3-heptanedione |
Angielska nazwa |
2,3-heptanedione;2,3-Heptanedione; Acetyl pentanoyl; Acetyl valeryl; FEMA No. 2543; NSC 31668; UNII-DK55DDE86P; Valerylacetyl; heptane-2,3-dione |
MF |
C7H12O2 |
Masie cząsteczkowej |
128.169 |
InChI |
InChI=1/C7H12O2/c1-3-4-5-7(9)6(2)8/h3-5H2,1-2H3 |
Nr CAS |
96-04-8 |
EINECS |
202-472-5 |
Struktury molekularnej |
|
Gęstość |
0.926g/cm3 |
Temperatura wrzenia |
149.7°C at 760 mmHg |
Współczynnik załamania |
1.413 |
Temperatura zapłonu |
45°C |
Ciśnienie pary |
3.98mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R10:Flammable.;
|
Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|