ChemNet > CAS > 98041-44-2 2-Iodophenyl isothiocyanate
98041-44-2 2-Iodophenyl isothiocyanate
| Nazwa produktu: |
2-Iodophenyl isothiocyanate |
| Angielska nazwa |
2-Iodophenyl isothiocyanate; 2-Iodoisothiocyanatobenzene; 1-iodo-2-isothiocyanatobenzene |
| MF |
C7H4INS |
| Masie cząsteczkowej |
261.0828 |
| InChI |
InChI=1/C7H4INS/c8-6-3-1-2-4-7(6)9-5-10/h1-4H |
| Nr CAS |
98041-44-2 |
| Struktury molekularnej |
|
| Gęstość |
1.76g/cm3 |
| Temperatura topnienia |
36-39℃ |
| Temperatura wrzenia |
304.2°C at 760 mmHg |
| Współczynnik załamania |
1.672 |
| Temperatura zapłonu |
137.8°C |
| Ciśnienie pary |
0.0016mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
