ChemNet > CAS > 98041-69-1 4-bromo-2-chlorophenyl isothiocyanate
98041-69-1 4-bromo-2-chlorophenyl isothiocyanate
| Nazwa produktu: |
4-bromo-2-chlorophenyl isothiocyanate |
| Angielska nazwa |
4-bromo-2-chlorophenyl isothiocyanate; 4-Bromo-2-chloroisothiocyanatobenzene; 1-bromo-2-chloro-4-isothiocyanatobenzene; 4-bromo-2-chloro-1-isothiocyanatobenzene |
| MF |
C7H3BrClNS |
| Masie cząsteczkowej |
248.5274 |
| InChI |
InChI=1/C7H3BrClNS/c8-5-1-2-7(10-4-11)6(9)3-5/h1-3H |
| Nr CAS |
98041-69-1 |
| Struktury molekularnej |
|
| Gęstość |
1.63g/cm3 |
| Temperatura topnienia |
46-48℃ |
| Temperatura wrzenia |
315.2°C at 760 mmHg |
| Współczynnik załamania |
1.641 |
| Temperatura zapłonu |
144.4°C |
| Ciśnienie pary |
0.000823mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
