ChemNet > CAS > 106-57-0 Glycine anhydride
106-57-0 Glycine anhydride
| Nome do produto |
Glycine anhydride |
| Nome em inglês |
Glycine anhydride; 2,5-Diketopiperazine; 2,5-Piperazinedione,(Glycine anhydride); Dioxo Piperazine; Cyclo(-Gly-Gly); 2,5-Piperazinedione; piperazine-2,5-dione; piperazine-2,3-dione |
| Fórmula molecular |
C4H6N2O2 |
| Peso Molecular |
114.1026 |
| InChI |
InChI=1/C4H6N2O2/c7-3-4(8)6-2-1-5-3/h1-2H2,(H,5,7)(H,6,8) |
| CAS Registry Number |
106-57-0 |
| EINECS |
203-411-5 |
| Estrutura Molecular |
|
| Densidade |
1.246g/cm3 |
| Ponto de fusão |
300℃ |
| índice de refração |
1.467 |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
