ChemNet > CAS > 1198-37-4 2,4-dimethylquinoline
1198-37-4 2,4-dimethylquinoline
| Nome do produto |
2,4-dimethylquinoline |
| Nome em inglês |
2,4-dimethylquinoline; Dimethylquinoline |
| Fórmula molecular |
C11H11N |
| Peso Molecular |
157.2117 |
| InChI |
InChI=1/C11H11N/c1-8-7-9(2)12-11-6-4-3-5-10(8)11/h3-7H,1-2H3 |
| CAS Registry Number |
1198-37-4 |
| EINECS |
214-832-9 |
| Estrutura Molecular |
|
| Densidade |
1.052g/cm3 |
| Ponto de ebulição |
263.8°C at 760 mmHg |
| índice de refração |
1.61 |
| O ponto de inflamação |
107.6°C |
| Pressão de vapor |
0.0164mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
