ChemNet > CAS > 135-00-2 2-Benzoylthiophene
135-00-2 2-Benzoylthiophene
| Nome do produto |
2-Benzoylthiophene |
| Nome em inglês |
2-Benzoylthiophene; 2-Benzoylthiophene, (Phenyl 2-thienyl ketone); Phenyl 2-thienyl ketone; phenyl(thiophen-2-yl)methanone |
| Fórmula molecular |
C11H8OS |
| Peso Molecular |
188.2456 |
| InChI |
InChI=1/C11H8OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8H |
| CAS Registry Number |
135-00-2 |
| EINECS |
205-169-6 |
| Estrutura Molecular |
|
| Densidade |
1.198g/cm3 |
| Ponto de ebulição |
300°C at 760 mmHg |
| índice de refração |
1.609 |
| O ponto de inflamação |
139.7°C |
| Pressão de vapor |
0.00115mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
