ChemNet > CAS > 13524-04-4 1-(2-Chlorophenyl)ethanol
13524-04-4 1-(2-Chlorophenyl)ethanol
| Nome do produto |
1-(2-Chlorophenyl)ethanol |
| Nome em inglês |
1-(2-Chlorophenyl)ethanol; 2-Chloro-alpha-methylbenzyl alcohol; (1S)-1-(2-chlorophenyl)ethanol; (1R)-1-(2-chlorophenyl)ethanol |
| Fórmula molecular |
C8H9ClO |
| Peso Molecular |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c1-6(10)7-4-2-3-5-8(7)9/h2-6,10H,1H3/t6-/m1/s1 |
| CAS Registry Number |
13524-04-4 |
| EINECS |
236-868-4 |
| Estrutura Molecular |
|
| Densidade |
1.182g/cm3 |
| Ponto de ebulição |
231.4°C at 760 mmHg |
| índice de refração |
1.55 |
| O ponto de inflamação |
93.8°C |
| Pressão de vapor |
0.0348mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
