ChemNet > CAS > 15547-89-4 2-(3-Methoxyphenyl)cyclohexanone
15547-89-4 2-(3-Methoxyphenyl)cyclohexanone
| Nome do produto |
2-(3-Methoxyphenyl)cyclohexanone |
| Nome em inglês |
2-(3-Methoxyphenyl)cyclohexanone;Cyclohexanone, 2-(3-methoxyphenyl)-; (2R)-2-(3-methoxyphenyl)cyclohexanone; (2S)-2-(3-methoxyphenyl)cyclohexanone |
| Fórmula molecular |
C13H16O2 |
| Peso Molecular |
204.2649 |
| InChI |
InChI=1/C13H16O2/c1-15-11-6-4-5-10(9-11)12-7-2-3-8-13(12)14/h4-6,9,12H,2-3,7-8H2,1H3/t12-/m0/s1 |
| CAS Registry Number |
15547-89-4 |
| EINECS |
239-602-5 |
| Estrutura Molecular |
|
| Densidade |
1.068g/cm3 |
| Ponto de ebulição |
332.6°C at 760 mmHg |
| índice de refração |
1.528 |
| O ponto de inflamação |
147.8°C |
| Pressão de vapor |
0.000144mmHg at 25°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
