1711-10-0 3-iodobenzoyl chloride
Nome do produto |
3-iodobenzoyl chloride |
Nome em inglês |
3-iodobenzoyl chloride; |
Fórmula molecular |
C7H4ClIO |
Peso Molecular |
266.46 |
InChI |
InChI=1/C7H4ClIO/c8-7(10)5-2-1-3-6(9)4-5/h1-4H |
CAS Registry Number |
1711-10-0 |
EINECS |
216-979-4 |
Estrutura Molecular |
|
Símbolos de perigo |
|
Códigos de risco |
R34:Causes burns.;
|
Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|